C26H33FN6O — CID 134099738
N'-(4-aminocyclohexyl)-N-(3-fluorophenyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboximidamide (PubChem CID 134099738) has the molecular formula C26H33FN6O and a molecular weight of 464.59 g/mol. Its IUPAC name is N'-(4-aminocyclohexyl)-N-(3-fluorophenyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboximidamide.
| Compound Name | N'-(4-aminocyclohexyl)-N-(3-fluorophenyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboximidamide |
|---|---|
| PubChem CID | 134099738 |
| Molecular Formula | C26H33FN6O |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | N'-(4-aminocyclohexyl)-N-(3-fluorophenyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboximidamide |
| SMILES | NC1CCC(/N=C(/Nc2cccc(F)c2)N2CCC3(CC2)C(=O)NCN3c2ccccc2)CC1 |
| InChI | InChI=1S/C26H33FN6O/c27-19-5-4-6-22(17-19)31-25(30-21-11-9-20(28)10-12-21)32-15-13-26(14-16-32)24(34)29-18-33(26)23-7-2-1-3-8-23/h1-8,17,20-21H,9-16,18,28H2,(H,29,34)(H,30,31) |
| InChIKey | SFDZLFFCIHOOGZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|