C19H27N3O — CID 11781971
8-cyclohexyl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 11781971) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is 8-cyclohexyl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-cyclohexyl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 11781971 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 8-cyclohexyl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | O=C1NCN(c2ccccc2)C12CCN(C1CCCCC1)CC2 |
| InChI | InChI=1S/C19H27N3O/c23-18-19(22(15-20-18)17-9-5-2-6-10-17)11-13-21(14-12-19)16-7-3-1-4-8-16/h2,5-6,9-10,16H,1,3-4,7-8,11-15H2,(H,20,23) |
| InChIKey | RKHMTVPPDQEMGU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |