C20H38N4 — CID 134539127
2-(3-amino-2-methylcyclohexyl)-1,3-dicyclohexylguanidine (PubChem CID 134539127) has the molecular formula C20H38N4 and a molecular weight of 334.55 g/mol. Its IUPAC name is 2-(3-amino-2-methylcyclohexyl)-1,3-dicyclohexylguanidine.
| Compound Name | 2-(3-amino-2-methylcyclohexyl)-1,3-dicyclohexylguanidine |
|---|---|
| PubChem CID | 134539127 |
| Molecular Formula | C20H38N4 |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 334.31 |
| IUPAC Name | 2-(3-amino-2-methylcyclohexyl)-1,3-dicyclohexylguanidine |
| SMILES | CC1C(N)CCCC1N=C(NC1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C20H38N4/c1-15-18(21)13-8-14-19(15)24-20(22-16-9-4-2-5-10-16)23-17-11-6-3-7-12-17/h15-19H,2-14,21H2,1H3,(H2,22,23,24) |
| InChIKey | HMXZSWXBQQVDKA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|