C13H16F2N2S — CID 7342635
(2R)-N-(3,5-difluorophenyl)-2-methylpiperidine-1-carbothioamide (PubChem CID 7342635) has the molecular formula C13H16F2N2S and a molecular weight of 270.35 g/mol. Its IUPAC name is (2R)-N-(3,5-difluorophenyl)-2-methylpiperidine-1-carbothioamide.
| Compound Name | (2R)-N-(3,5-difluorophenyl)-2-methylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 7342635 |
| Molecular Formula | C13H16F2N2S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (2R)-N-(3,5-difluorophenyl)-2-methylpiperidine-1-carbothioamide |
| SMILES | C[C@@H]1CCCCN1C(=S)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H16F2N2S/c1-9-4-2-3-5-17(9)13(18)16-12-7-10(14)6-11(15)8-12/h6-9H,2-5H2,1H3,(H,16,18)/t9-/m1/s1 |
| InChIKey | QVGMLWOHNQEHOT-SECBINFHSA-N |
| XLogP | 3.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|