C15H23N3O2S2 — CID 27518485
(2R)-N-[4-(ethylsulfamoyl)phenyl]-2-methylpiperidine-1-carbothioamide (PubChem CID 27518485) has the molecular formula C15H23N3O2S2 and a molecular weight of 341.50 g/mol. Its IUPAC name is (2R)-N-[4-(ethylsulfamoyl)phenyl]-2-methylpiperidine-1-carbothioamide.
| Compound Name | (2R)-N-[4-(ethylsulfamoyl)phenyl]-2-methylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 27518485 |
| Molecular Formula | C15H23N3O2S2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | (2R)-N-[4-(ethylsulfamoyl)phenyl]-2-methylpiperidine-1-carbothioamide |
| SMILES | CCNS(=O)(=O)c1ccc(NC(=S)N2CCCC[C@H]2C)cc1 |
| InChI | InChI=1S/C15H23N3O2S2/c1-3-16-22(19,20)14-9-7-13(8-10-14)17-15(21)18-11-5-4-6-12(18)2/h7-10,12,16H,3-6,11H2,1-2H3,(H,17,21)/t12-/m1/s1 |
| InChIKey | WCWYDMYTWQYLLV-GFCCVEGCSA-N |
| XLogP | 2.56 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|