C26H25FN4O — CID 54201843
N-[(4-fluoroanilino)-(2-methylphenyl)methylidene]-4-oxo-N'-phenylpiperidine-1-carboximidamide (PubChem CID 54201843) has the molecular formula C26H25FN4O and a molecular weight of 428.51 g/mol. Its IUPAC name is N-[(4-fluoroanilino)-(2-methylphenyl)methylidene]-4-oxo-N'-phenylpiperidine-1-carboximidamide.
| Compound Name | N-[(4-fluoroanilino)-(2-methylphenyl)methylidene]-4-oxo-N'-phenylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 54201843 |
| Molecular Formula | C26H25FN4O |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | N-[(4-fluoroanilino)-(2-methylphenyl)methylidene]-4-oxo-N'-phenylpiperidine-1-carboximidamide |
| SMILES | Cc1ccccc1C(=N/C(=N/c1ccccc1)N1CCC(=O)CC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C26H25FN4O/c1-19-7-5-6-10-24(19)25(28-22-13-11-20(27)12-14-22)30-26(29-21-8-3-2-4-9-21)31-17-15-23(32)16-18-31/h2-14H,15-18H2,1H3,(H,28,29,30) |
| InChIKey | PPUKATKWSZHVQS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|