C19H23N3 — CID 138974908
N'-(4-methylphenyl)-N-phenylpiperidine-1-carboximidamide (PubChem CID 138974908) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is N'-(4-methylphenyl)-N-phenylpiperidine-1-carboximidamide.
| Compound Name | N'-(4-methylphenyl)-N-phenylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 138974908 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | N'-(4-methylphenyl)-N-phenylpiperidine-1-carboximidamide |
| SMILES | Cc1ccc(/N=C(\Nc2ccccc2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C19H23N3/c1-16-10-12-18(13-11-16)21-19(22-14-6-3-7-15-22)20-17-8-4-2-5-9-17/h2,4-5,8-13H,3,6-7,14-15H2,1H3,(H,20,21) |
| InChIKey | FCVSVJSFXMWNPF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|