C20H23N3S — CID 3166053
N-[(2-methylanilino)-phenylmethylidene]piperidine-1-carbothioamide (PubChem CID 3166053) has the molecular formula C20H23N3S and a molecular weight of 337.49 g/mol. Its IUPAC name is N-[(2-methylanilino)-phenylmethylidene]piperidine-1-carbothioamide.
| Compound Name | N-[(2-methylanilino)-phenylmethylidene]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3166053 |
| Molecular Formula | C20H23N3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | N-[(2-methylanilino)-phenylmethylidene]piperidine-1-carbothioamide |
| SMILES | Cc1ccccc1NC(=NC(=S)N1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C20H23N3S/c1-16-10-6-7-13-18(16)21-19(17-11-4-2-5-12-17)22-20(24)23-14-8-3-9-15-23/h2,4-7,10-13H,3,8-9,14-15H2,1H3,(H,21,22,24) |
| InChIKey | RRBLPJXZIVCJAL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|