C19H24ClN5 — CID 23459647
(NE)-N-[amino(phenyl)methylidene]-4-methyl-N'-phenylpiperazine-1-carboximidamide;hydrochloride (PubChem CID 23459647) has the molecular formula C19H24ClN5 and a molecular weight of 357.89 g/mol. Its IUPAC name is (NE)-N-[amino(phenyl)methylidene]-4-methyl-N'-phenylpiperazine-1-carboximidamide;hydrochloride.
| Compound Name | (NE)-N-[amino(phenyl)methylidene]-4-methyl-N'-phenylpiperazine-1-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 23459647 |
| Molecular Formula | C19H24ClN5 |
| Molecular Weight | 357.89 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (NE)-N-[amino(phenyl)methylidene]-4-methyl-N'-phenylpiperazine-1-carboximidamide;hydrochloride |
| SMILES | CN1CCN(C(=N/c2ccccc2)/N=C(/N)c2ccccc2)CC1.Cl |
| InChI | InChI=1S/C19H23N5.ClH/c1-23-12-14-24(15-13-23)19(21-17-10-6-3-7-11-17)22-18(20)16-8-4-2-5-9-16;/h2-11H,12-15H2,1H3,(H2,20,21,22);1H |
| InChIKey | RILJIYGCMZFNSM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 57.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.89 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|