C18H21ClN4S — CID 23459671
(NZ)-N-[amino(phenyl)methylidene]-N'-phenylthiomorpholine-4-carboximidamide;hydrochloride (PubChem CID 23459671) has the molecular formula C18H21ClN4S and a molecular weight of 360.91 g/mol. Its IUPAC name is (NZ)-N-[amino(phenyl)methylidene]-N'-phenylthiomorpholine-4-carboximidamide;hydrochloride.
| Compound Name | (NZ)-N-[amino(phenyl)methylidene]-N'-phenylthiomorpholine-4-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 23459671 |
| Molecular Formula | C18H21ClN4S |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (NZ)-N-[amino(phenyl)methylidene]-N'-phenylthiomorpholine-4-carboximidamide;hydrochloride |
| SMILES | Cl.N/C(=N\C(=N\c1ccccc1)N1CCSCC1)c1ccccc1 |
| InChI | InChI=1S/C18H20N4S.ClH/c19-17(15-7-3-1-4-8-15)21-18(22-11-13-23-14-12-22)20-16-9-5-2-6-10-16;/h1-10H,11-14H2,(H2,19,20,21);1H |
| InChIKey | XGGHSMTZEXGXPS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|