C18H19ClN4O — CID 70567672
N-[amino(phenyl)methylidene]-N'-(4-chlorophenyl)morpholine-4-carboximidamide (PubChem CID 70567672) has the molecular formula C18H19ClN4O and a molecular weight of 342.83 g/mol. Its IUPAC name is N-[amino(phenyl)methylidene]-N'-(4-chlorophenyl)morpholine-4-carboximidamide.
| Compound Name | N-[amino(phenyl)methylidene]-N'-(4-chlorophenyl)morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 70567672 |
| Molecular Formula | C18H19ClN4O |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-[amino(phenyl)methylidene]-N'-(4-chlorophenyl)morpholine-4-carboximidamide |
| SMILES | NC(=N/C(=N\c1ccc(Cl)cc1)N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C18H19ClN4O/c19-15-6-8-16(9-7-15)21-18(23-10-12-24-13-11-23)22-17(20)14-4-2-1-3-5-14/h1-9H,10-13H2,(H2,20,21,22) |
| InChIKey | PLMMZRYSXSGARE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|