C19H22N4O2 — CID 23459640
(NZ)-N-[amino-(2-methoxyphenyl)methylidene]-N'-phenylmorpholine-4-carboximidamide (PubChem CID 23459640) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is (NZ)-N-[amino-(2-methoxyphenyl)methylidene]-N'-phenylmorpholine-4-carboximidamide.
| Compound Name | (NZ)-N-[amino-(2-methoxyphenyl)methylidene]-N'-phenylmorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 23459640 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (NZ)-N-[amino-(2-methoxyphenyl)methylidene]-N'-phenylmorpholine-4-carboximidamide |
| SMILES | COc1ccccc1/C(N)=N/C(=N/c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C19H22N4O2/c1-24-17-10-6-5-9-16(17)18(20)22-19(23-11-13-25-14-12-23)21-15-7-3-2-4-8-15/h2-10H,11-14H2,1H3,(H2,20,21,22) |
| InChIKey | QMQNDWJXMWEADM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|