C13H20ClN5O — CID 67444929
2-[3-(4-methylpiperazine-1-carbonyl)phenyl]guanidine;hydrochloride (PubChem CID 67444929) has the molecular formula C13H20ClN5O and a molecular weight of 297.79 g/mol. Its IUPAC name is 2-[3-(4-methylpiperazine-1-carbonyl)phenyl]guanidine;hydrochloride.
| Compound Name | 2-[3-(4-methylpiperazine-1-carbonyl)phenyl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 67444929 |
| Molecular Formula | C13H20ClN5O |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-[3-(4-methylpiperazine-1-carbonyl)phenyl]guanidine;hydrochloride |
| SMILES | CN1CCN(C(=O)c2cccc(N=C(N)N)c2)CC1.Cl |
| InChI | InChI=1S/C13H19N5O.ClH/c1-17-5-7-18(8-6-17)12(19)10-3-2-4-11(9-10)16-13(14)15;/h2-4,9H,5-8H2,1H3,(H4,14,15,16);1H |
| InChIKey | NSXXISKORIPSKH-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|