C26H25F3N4O — CID 122434974
N'-[3-(4-benzhydrylpiperazine-1-carbonyl)phenyl]-2,2,2-trifluoroethanimidamide (PubChem CID 122434974) has the molecular formula C26H25F3N4O and a molecular weight of 466.51 g/mol. Its IUPAC name is N'-[3-(4-benzhydrylpiperazine-1-carbonyl)phenyl]-2,2,2-trifluoroethanimidamide.
| Compound Name | N'-[3-(4-benzhydrylpiperazine-1-carbonyl)phenyl]-2,2,2-trifluoroethanimidamide |
|---|---|
| PubChem CID | 122434974 |
| Molecular Formula | C26H25F3N4O |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | N'-[3-(4-benzhydrylpiperazine-1-carbonyl)phenyl]-2,2,2-trifluoroethanimidamide |
| SMILES | N/C(=N\c1cccc(C(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)c1)C(F)(F)F |
| InChI | InChI=1S/C26H25F3N4O/c27-26(28,29)25(30)31-22-13-7-12-21(18-22)24(34)33-16-14-32(15-17-33)23(19-8-3-1-4-9-19)20-10-5-2-6-11-20/h1-13,18,23H,14-17H2,(H2,30,31) |
| InChIKey | NLYUOQPVCVAOPJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|