C31H38N8O4 — CID 122193301
N-[(2S)-1-[[(2S)-6-amino-1-[[(1S)-2-amino-2-oxo-1-phenylethyl]amino]-1-oxohexan-2-yl]amino]-3-[3-(diaminomethylideneamino)phenyl]-1-oxopropan-2-yl]benzamide (PubChem CID 122193301) has the molecular formula C31H38N8O4 and a molecular weight of 586.70 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S)-6-amino-1-[[(1S)-2-amino-2-oxo-1-phenylethyl]amino]-1-oxohexan-2-yl]amino]-3-[3-(diaminomethylideneamino)phenyl]-1-oxopropan-2-yl]benzamide.
| Compound Name | N-[(2S)-1-[[(2S)-6-amino-1-[[(1S)-2-amino-2-oxo-1-phenylethyl]amino]-1-oxohexan-2-yl]amino]-3-[3-(diaminomethylideneamino)phenyl]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 122193301 |
| Molecular Formula | C31H38N8O4 |
| Molecular Weight | 586.70 g/mol |
| Exact Mass | 586.30 |
| IUPAC Name | N-[(2S)-1-[[(2S)-6-amino-1-[[(1S)-2-amino-2-oxo-1-phenylethyl]amino]-1-oxohexan-2-yl]amino]-3-[3-(diaminomethylideneamino)phenyl]-1-oxopropan-2-yl]benzamide |
| SMILES | NCCCC[C@H](NC(=O)[C@H](Cc1cccc(N=C(N)N)c1)NC(=O)c1ccccc1)C(=O)N[C@H](C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C31H38N8O4/c32-17-8-7-16-24(29(42)39-26(27(33)40)21-11-3-1-4-12-21)37-30(43)25(38-28(41)22-13-5-2-6-14-22)19-20-10-9-15-23(18-20)36-31(34)35/h1-6,9-15,18,24-26H,7-8,16-17,19,32H2,(H2,33,40)(H,37,43)(H,38,41)(H,39,42)(H4,34,35,36)/t24-,25-,26-/m0/s1 |
| InChIKey | YOGVCPCMTFZHRO-GSDHBNRESA-N |
| XLogP | 0.89 |
| TPSA | 220.81 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.70 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|