C32H38N6O5 — CID 122193295
N-[(2S)-3-(4-acetamidophenyl)-1-[[(2S)-6-amino-1-[[(1S)-2-amino-2-oxo-1-phenylethyl]amino]-1-oxohexan-2-yl]amino]-1-oxopropan-2-yl]benzamide (PubChem CID 122193295) has the molecular formula C32H38N6O5 and a molecular weight of 586.69 g/mol. Its IUPAC name is N-[(2S)-3-(4-acetamidophenyl)-1-[[(2S)-6-amino-1-[[(1S)-2-amino-2-oxo-1-phenylethyl]amino]-1-oxohexan-2-yl]amino]-1-oxopropan-2-yl]benzamide.
| Compound Name | N-[(2S)-3-(4-acetamidophenyl)-1-[[(2S)-6-amino-1-[[(1S)-2-amino-2-oxo-1-phenylethyl]amino]-1-oxohexan-2-yl]amino]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 122193295 |
| Molecular Formula | C32H38N6O5 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.29 |
| IUPAC Name | N-[(2S)-3-(4-acetamidophenyl)-1-[[(2S)-6-amino-1-[[(1S)-2-amino-2-oxo-1-phenylethyl]amino]-1-oxohexan-2-yl]amino]-1-oxopropan-2-yl]benzamide |
| SMILES | CC(=O)Nc1ccc(C[C@H](NC(=O)c2ccccc2)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(N)=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H38N6O5/c1-21(39)35-25-17-15-22(16-18-25)20-27(37-30(41)24-12-6-3-7-13-24)32(43)36-26(14-8-9-19-33)31(42)38-28(29(34)40)23-10-4-2-5-11-23/h2-7,10-13,15-18,26-28H,8-9,14,19-20,33H2,1H3,(H2,34,40)(H,35,39)(H,36,43)(H,37,41)(H,38,42)/t26-,27-,28-/m0/s1 |
| InChIKey | KISLFRKSBCYWLR-KCHLEUMXSA-N |
| XLogP | 1.94 |
| TPSA | 185.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|