C29H31N5Si — CID 139156190
N'-[[[anilino(phenyl)methylidene]amino]-(dimethylamino)-methylsilyl]-N-phenylbenzenecarboximidamide (PubChem CID 139156190) has the molecular formula C29H31N5Si and a molecular weight of 477.69 g/mol. Its IUPAC name is N'-[[[anilino(phenyl)methylidene]amino]-(dimethylamino)-methylsilyl]-N-phenylbenzenecarboximidamide.
| Compound Name | N'-[[[anilino(phenyl)methylidene]amino]-(dimethylamino)-methylsilyl]-N-phenylbenzenecarboximidamide |
|---|---|
| PubChem CID | 139156190 |
| Molecular Formula | C29H31N5Si |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | N'-[[[anilino(phenyl)methylidene]amino]-(dimethylamino)-methylsilyl]-N-phenylbenzenecarboximidamide |
| SMILES | CN(C)[Si](C)(N=C(Nc1ccccc1)c1ccccc1)N=C(Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H31N5Si/c1-34(2)35(3,32-28(24-16-8-4-9-17-24)30-26-20-12-6-13-21-26)33-29(25-18-10-5-11-19-25)31-27-22-14-7-15-23-27/h4-23H,1-3H3,(H,30,32)(H,31,33) |
| InChIKey | CRSGTIVKHASMAS-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|