C23H27Br2N3O — CID 12935403
N'-[4-[2-(dimethylamino)ethoxy]phenyl]-N-phenylbenzenecarboximidamide;dihydrobromide (PubChem CID 12935403) has the molecular formula C23H27Br2N3O and a molecular weight of 521.30 g/mol. Its IUPAC name is N'-[4-[2-(dimethylamino)ethoxy]phenyl]-N-phenylbenzenecarboximidamide;dihydrobromide.
| Compound Name | N'-[4-[2-(dimethylamino)ethoxy]phenyl]-N-phenylbenzenecarboximidamide;dihydrobromide |
|---|---|
| PubChem CID | 12935403 |
| Molecular Formula | C23H27Br2N3O |
| Molecular Weight | 521.30 g/mol |
| Exact Mass | 519.05 |
| IUPAC Name | N'-[4-[2-(dimethylamino)ethoxy]phenyl]-N-phenylbenzenecarboximidamide;dihydrobromide |
| SMILES | Br.Br.CN(C)CCOc1ccc(/N=C(\Nc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H25N3O.2BrH/c1-26(2)17-18-27-22-15-13-21(14-16-22)25-23(19-9-5-3-6-10-19)24-20-11-7-4-8-12-20;;/h3-16H,17-18H2,1-2H3,(H,24,25);2*1H |
| InChIKey | UQGMHBQVHMKVDM-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.30 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|