C31H30N2O3 — CID 42603085
N-[4-[2-(dimethylamino)ethoxy]phenyl]-2-(4-hydroxyphenyl)-3,3-diphenylprop-2-enamide (PubChem CID 42603085) has the molecular formula C31H30N2O3 and a molecular weight of 478.59 g/mol. Its IUPAC name is N-[4-[2-(dimethylamino)ethoxy]phenyl]-2-(4-hydroxyphenyl)-3,3-diphenylprop-2-enamide.
| Compound Name | N-[4-[2-(dimethylamino)ethoxy]phenyl]-2-(4-hydroxyphenyl)-3,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 42603085 |
| Molecular Formula | C31H30N2O3 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | N-[4-[2-(dimethylamino)ethoxy]phenyl]-2-(4-hydroxyphenyl)-3,3-diphenylprop-2-enamide |
| SMILES | CN(C)CCOc1ccc(NC(=O)C(=C(c2ccccc2)c2ccccc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C31H30N2O3/c1-33(2)21-22-36-28-19-15-26(16-20-28)32-31(35)30(25-13-17-27(34)18-14-25)29(23-9-5-3-6-10-23)24-11-7-4-8-12-24/h3-20,34H,21-22H2,1-2H3,(H,32,35) |
| InChIKey | KSIHSIBBTGVEFP-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|