C29H34N2O5 — CID 68733618
(E)-N-[4-[2-(dimethylamino)ethoxy]phenyl]-5-hydroxy-2-[4-(methoxymethoxy)phenyl]-3-phenylpent-2-enamide (PubChem CID 68733618) has the molecular formula C29H34N2O5 and a molecular weight of 490.60 g/mol. Its IUPAC name is (E)-N-[4-[2-(dimethylamino)ethoxy]phenyl]-5-hydroxy-2-[4-(methoxymethoxy)phenyl]-3-phenylpent-2-enamide.
| Compound Name | (E)-N-[4-[2-(dimethylamino)ethoxy]phenyl]-5-hydroxy-2-[4-(methoxymethoxy)phenyl]-3-phenylpent-2-enamide |
|---|---|
| PubChem CID | 68733618 |
| Molecular Formula | C29H34N2O5 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | (E)-N-[4-[2-(dimethylamino)ethoxy]phenyl]-5-hydroxy-2-[4-(methoxymethoxy)phenyl]-3-phenylpent-2-enamide |
| SMILES | COCOc1ccc(/C(C(=O)Nc2ccc(OCCN(C)C)cc2)=C(/CCO)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H34N2O5/c1-31(2)18-20-35-25-15-11-24(12-16-25)30-29(33)28(23-9-13-26(14-10-23)36-21-34-3)27(17-19-32)22-7-5-4-6-8-22/h4-16,32H,17-21H2,1-3H3,(H,30,33)/b28-27+ |
| InChIKey | XRHYSRIWCKTHMY-BYYHNAKLSA-N |
| XLogP | 4.54 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|