C27H30N2O4 — CID 68732320
N-[4-[2-(dimethylamino)ethoxy]phenyl]-2,3-bis(4-hydroxyphenyl)pent-2-enamide (PubChem CID 68732320) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-[4-[2-(dimethylamino)ethoxy]phenyl]-2,3-bis(4-hydroxyphenyl)pent-2-enamide.
| Compound Name | N-[4-[2-(dimethylamino)ethoxy]phenyl]-2,3-bis(4-hydroxyphenyl)pent-2-enamide |
|---|---|
| PubChem CID | 68732320 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | N-[4-[2-(dimethylamino)ethoxy]phenyl]-2,3-bis(4-hydroxyphenyl)pent-2-enamide |
| SMILES | CCC(=C(C(=O)Nc1ccc(OCCN(C)C)cc1)c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C27H30N2O4/c1-4-25(19-5-11-22(30)12-6-19)26(20-7-13-23(31)14-8-20)27(32)28-21-9-15-24(16-10-21)33-18-17-29(2)3/h5-16,30-31H,4,17-18H2,1-3H3,(H,28,32) |
| InChIKey | ZYQIVNYHJRRBAT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|