C25H27N3O — CID 141019971
N-[(Z)-1,2-dihydroindol-3-ylidene(phenyl)methyl]-4-[2-(dimethylamino)ethoxy]aniline (PubChem CID 141019971) has the molecular formula C25H27N3O and a molecular weight of 385.51 g/mol. Its IUPAC name is N-[(Z)-1,2-dihydroindol-3-ylidene(phenyl)methyl]-4-[2-(dimethylamino)ethoxy]aniline.
| Compound Name | N-[(Z)-1,2-dihydroindol-3-ylidene(phenyl)methyl]-4-[2-(dimethylamino)ethoxy]aniline |
|---|---|
| PubChem CID | 141019971 |
| Molecular Formula | C25H27N3O |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | N-[(Z)-1,2-dihydroindol-3-ylidene(phenyl)methyl]-4-[2-(dimethylamino)ethoxy]aniline |
| SMILES | CN(C)CCOc1ccc(N/C(=C2\CNc3ccccc32)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H27N3O/c1-28(2)16-17-29-21-14-12-20(13-15-21)27-25(19-8-4-3-5-9-19)23-18-26-24-11-7-6-10-22(23)24/h3-15,26-27H,16-18H2,1-2H3/b25-23+ |
| InChIKey | XUXOQFMYPSUOIY-WJTDDFOZSA-N |
| XLogP | 5.03 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|