C30H40ClN3O — CID 45261693
N'-[4-[3-(dibutylamino)propoxy]phenyl]-N-phenylbenzenecarboximidamide;hydrochloride (PubChem CID 45261693) has the molecular formula C30H40ClN3O and a molecular weight of 494.12 g/mol. Its IUPAC name is N'-[4-[3-(dibutylamino)propoxy]phenyl]-N-phenylbenzenecarboximidamide;hydrochloride.
| Compound Name | N'-[4-[3-(dibutylamino)propoxy]phenyl]-N-phenylbenzenecarboximidamide;hydrochloride |
|---|---|
| PubChem CID | 45261693 |
| Molecular Formula | C30H40ClN3O |
| Molecular Weight | 494.12 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | N'-[4-[3-(dibutylamino)propoxy]phenyl]-N-phenylbenzenecarboximidamide;hydrochloride |
| SMILES | CCCCN(CCCC)CCCOc1ccc(/N=C(\Nc2ccccc2)c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C30H39N3O.ClH/c1-3-5-22-33(23-6-4-2)24-13-25-34-29-20-18-28(19-21-29)32-30(26-14-9-7-10-15-26)31-27-16-11-8-12-17-27;/h7-12,14-21H,3-6,13,22-25H2,1-2H3,(H,31,32);1H |
| InChIKey | XAOHQVKJAIWNQK-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.12 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|