C45H45N7 — CID 102109940
N'-[2-[bis[2-[[anilino(phenyl)methylidene]amino]ethyl]amino]ethyl]-N-phenylbenzenecarboximidamide (PubChem CID 102109940) has the molecular formula C45H45N7 and a molecular weight of 683.90 g/mol. Its IUPAC name is N'-[2-[bis[2-[[anilino(phenyl)methylidene]amino]ethyl]amino]ethyl]-N-phenylbenzenecarboximidamide.
| Compound Name | N'-[2-[bis[2-[[anilino(phenyl)methylidene]amino]ethyl]amino]ethyl]-N-phenylbenzenecarboximidamide |
|---|---|
| PubChem CID | 102109940 |
| Molecular Formula | C45H45N7 |
| Molecular Weight | 683.90 g/mol |
| Exact Mass | 683.37 |
| IUPAC Name | N'-[2-[bis[2-[[anilino(phenyl)methylidene]amino]ethyl]amino]ethyl]-N-phenylbenzenecarboximidamide |
| SMILES | c1ccc(N/C(=N\CCN(CC/N=C(\Nc2ccccc2)c2ccccc2)CC/N=C(/Nc2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C45H45N7/c1-7-19-37(20-8-1)43(49-40-25-13-4-14-26-40)46-31-34-52(35-32-47-44(38-21-9-2-10-22-38)50-41-27-15-5-16-28-41)36-33-48-45(39-23-11-3-12-24-39)51-42-29-17-6-18-30-42/h1-30H,31-36H2,(H,46,49)(H,47,50)(H,48,51) |
| InChIKey | SCATXRCKUDPFFP-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 76.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.90 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|