C10H8ClN3S — CID 163644619
N'-chloro-N-phenyl-1,2-thiazole-4-carboximidamide (PubChem CID 163644619) has the molecular formula C10H8ClN3S and a molecular weight of 237.72 g/mol. Its IUPAC name is N'-chloro-N-phenyl-1,2-thiazole-4-carboximidamide.
| Compound Name | N'-chloro-N-phenyl-1,2-thiazole-4-carboximidamide |
|---|---|
| PubChem CID | 163644619 |
| Molecular Formula | C10H8ClN3S |
| Molecular Weight | 237.72 g/mol |
| Exact Mass | 237.01 |
| IUPAC Name | N'-chloro-N-phenyl-1,2-thiazole-4-carboximidamide |
| SMILES | ClN=C(Nc1ccccc1)c1cnsc1 |
| InChI | InChI=1S/C10H8ClN3S/c11-14-10(8-6-12-15-7-8)13-9-4-2-1-3-5-9/h1-7H,(H,13,14) |
| InChIKey | IHEVTLLXAXFSQD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.72 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|