C27H20ClN5O4S2 — CID 2355217
N'-(4-chlorophenyl)sulfonyl-N-[4-(quinoxalin-2-ylsulfamoyl)phenyl]benzenecarboximidamide (PubChem CID 2355217) has the molecular formula C27H20ClN5O4S2 and a molecular weight of 578.08 g/mol. Its IUPAC name is N'-(4-chlorophenyl)sulfonyl-N-[4-(quinoxalin-2-ylsulfamoyl)phenyl]benzenecarboximidamide.
| Compound Name | N'-(4-chlorophenyl)sulfonyl-N-[4-(quinoxalin-2-ylsulfamoyl)phenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 2355217 |
| Molecular Formula | C27H20ClN5O4S2 |
| Molecular Weight | 578.08 g/mol |
| Exact Mass | 577.06 |
| IUPAC Name | N'-(4-chlorophenyl)sulfonyl-N-[4-(quinoxalin-2-ylsulfamoyl)phenyl]benzenecarboximidamide |
| SMILES | O=S(=O)(N=C(Nc1ccc(S(=O)(=O)Nc2cnc3ccccc3n2)cc1)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H20ClN5O4S2/c28-20-10-14-22(15-11-20)39(36,37)33-27(19-6-2-1-3-7-19)30-21-12-16-23(17-13-21)38(34,35)32-26-18-29-24-8-4-5-9-25(24)31-26/h1-18H,(H,30,33)(H,31,32) |
| InChIKey | MFEKYMZHRYIDFD-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 130.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.08 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|