C19H18N4O5S — CID 22776249
5-oxo-5-[4-(quinoxalin-2-ylsulfamoyl)anilino]pentanoic acid (PubChem CID 22776249) has the molecular formula C19H18N4O5S and a molecular weight of 414.44 g/mol. Its IUPAC name is 5-oxo-5-[4-(quinoxalin-2-ylsulfamoyl)anilino]pentanoic acid.
| Compound Name | 5-oxo-5-[4-(quinoxalin-2-ylsulfamoyl)anilino]pentanoic acid |
|---|---|
| PubChem CID | 22776249 |
| Molecular Formula | C19H18N4O5S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 5-oxo-5-[4-(quinoxalin-2-ylsulfamoyl)anilino]pentanoic acid |
| SMILES | O=C(O)CCCC(=O)Nc1ccc(S(=O)(=O)Nc2cnc3ccccc3n2)cc1 |
| InChI | InChI=1S/C19H18N4O5S/c24-18(6-3-7-19(25)26)21-13-8-10-14(11-9-13)29(27,28)23-17-12-20-15-4-1-2-5-16(15)22-17/h1-2,4-5,8-12H,3,6-7H2,(H,21,24)(H,22,23)(H,25,26) |
| InChIKey | RYPXYVPEEDMJLF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 138.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |