C19H14N6O3S — CID 53382181
N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]quinoxaline-2-carboxamide (PubChem CID 53382181) has the molecular formula C19H14N6O3S and a molecular weight of 406.43 g/mol. Its IUPAC name is N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]quinoxaline-2-carboxamide.
| Compound Name | N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 53382181 |
| Molecular Formula | C19H14N6O3S |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]quinoxaline-2-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C19H14N6O3S/c26-18(17-12-22-15-4-1-2-5-16(15)24-17)23-13-6-8-14(9-7-13)29(27,28)25-19-20-10-3-11-21-19/h1-12H,(H,23,26)(H,20,21,25) |
| InChIKey | BDPGXPQMBHLTDK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 126.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |