C19H14ClN5O3S — CID 108791703
7-chloro-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]-1H-indole-2-carboxamide (PubChem CID 108791703) has the molecular formula C19H14ClN5O3S and a molecular weight of 427.87 g/mol. Its IUPAC name is 7-chloro-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]-1H-indole-2-carboxamide.
| Compound Name | 7-chloro-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 108791703 |
| Molecular Formula | C19H14ClN5O3S |
| Molecular Weight | 427.87 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | 7-chloro-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1)c1cc2cccc(Cl)c2[nH]1 |
| InChI | InChI=1S/C19H14ClN5O3S/c20-15-4-1-3-12-11-16(24-17(12)15)18(26)23-13-5-7-14(8-6-13)29(27,28)25-19-21-9-2-10-22-19/h1-11,24H,(H,23,26)(H,21,22,25) |
| InChIKey | UHBIDCQCWFMAIC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.87 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |