C22H16Cl2N2O2 — CID 108791740
7-chloro-N-[4-[(4-chlorophenyl)methoxy]phenyl]-1H-indole-2-carboxamide (PubChem CID 108791740) has the molecular formula C22H16Cl2N2O2 and a molecular weight of 411.29 g/mol. Its IUPAC name is 7-chloro-N-[4-[(4-chlorophenyl)methoxy]phenyl]-1H-indole-2-carboxamide.
| Compound Name | 7-chloro-N-[4-[(4-chlorophenyl)methoxy]phenyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 108791740 |
| Molecular Formula | C22H16Cl2N2O2 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 7-chloro-N-[4-[(4-chlorophenyl)methoxy]phenyl]-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1ccc(OCc2ccc(Cl)cc2)cc1)c1cc2cccc(Cl)c2[nH]1 |
| InChI | InChI=1S/C22H16Cl2N2O2/c23-16-6-4-14(5-7-16)13-28-18-10-8-17(9-11-18)25-22(27)20-12-15-2-1-3-19(24)21(15)26-20/h1-12,26H,13H2,(H,25,27) |
| InChIKey | AWLOPUOHIRBQPU-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |