C22H25ClN4O2 — CID 108791770
7-chloro-N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]-1H-indole-2-carboxamide (PubChem CID 108791770) has the molecular formula C22H25ClN4O2 and a molecular weight of 412.92 g/mol. Its IUPAC name is 7-chloro-N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]-1H-indole-2-carboxamide.
| Compound Name | 7-chloro-N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 108791770 |
| Molecular Formula | C22H25ClN4O2 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 7-chloro-N-[4-[2-(diethylamino)ethylcarbamoyl]phenyl]-1H-indole-2-carboxamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NC(=O)c2cc3cccc(Cl)c3[nH]2)cc1 |
| InChI | InChI=1S/C22H25ClN4O2/c1-3-27(4-2)13-12-24-21(28)15-8-10-17(11-9-15)25-22(29)19-14-16-6-5-7-18(23)20(16)26-19/h5-11,14,26H,3-4,12-13H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | DVPLEWUPBYTQNH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |