C17H24ClN3O — CID 108791742
7-chloro-N-[4-(diethylamino)butyl]-1H-indole-2-carboxamide (PubChem CID 108791742) has the molecular formula C17H24ClN3O and a molecular weight of 321.85 g/mol. Its IUPAC name is 7-chloro-N-[4-(diethylamino)butyl]-1H-indole-2-carboxamide.
| Compound Name | 7-chloro-N-[4-(diethylamino)butyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 108791742 |
| Molecular Formula | C17H24ClN3O |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 7-chloro-N-[4-(diethylamino)butyl]-1H-indole-2-carboxamide |
| SMILES | CCN(CC)CCCCNC(=O)c1cc2cccc(Cl)c2[nH]1 |
| InChI | InChI=1S/C17H24ClN3O/c1-3-21(4-2)11-6-5-10-19-17(22)15-12-13-8-7-9-14(18)16(13)20-15/h7-9,12,20H,3-6,10-11H2,1-2H3,(H,19,22) |
| InChIKey | XSTMVFWQANPQSN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|