C22H16ClN3O4 — CID 127051118
N-[4-[(4-chlorophenyl)methoxy]phenyl]-5-nitro-1H-indole-2-carboxamide (PubChem CID 127051118) has the molecular formula C22H16ClN3O4 and a molecular weight of 421.84 g/mol. Its IUPAC name is N-[4-[(4-chlorophenyl)methoxy]phenyl]-5-nitro-1H-indole-2-carboxamide.
| Compound Name | N-[4-[(4-chlorophenyl)methoxy]phenyl]-5-nitro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 127051118 |
| Molecular Formula | C22H16ClN3O4 |
| Molecular Weight | 421.84 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | N-[4-[(4-chlorophenyl)methoxy]phenyl]-5-nitro-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1ccc(OCc2ccc(Cl)cc2)cc1)c1cc2cc([N+](=O)[O-])ccc2[nH]1 |
| InChI | InChI=1S/C22H16ClN3O4/c23-16-3-1-14(2-4-16)13-30-19-8-5-17(6-9-19)24-22(27)21-12-15-11-18(26(28)29)7-10-20(15)25-21/h1-12,25H,13H2,(H,24,27) |
| InChIKey | ZPLVWLVSHBFYPH-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 97.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.84 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|