C21H19ClN4 — CID 145212338
4-[2-(aminomethyl)-5-chlorophenyl]-N'-(benzenecarboximidoyl)benzenecarboximidamide (PubChem CID 145212338) has the molecular formula C21H19ClN4 and a molecular weight of 362.86 g/mol. Its IUPAC name is 4-[2-(aminomethyl)-5-chlorophenyl]-N'-(benzenecarboximidoyl)benzenecarboximidamide.
| Compound Name | 4-[2-(aminomethyl)-5-chlorophenyl]-N'-(benzenecarboximidoyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 145212338 |
| Molecular Formula | C21H19ClN4 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 4-[2-(aminomethyl)-5-chlorophenyl]-N'-(benzenecarboximidoyl)benzenecarboximidamide |
| SMILES | [H]/N=C(/N=C(\N)c1ccc(-c2cc(Cl)ccc2CN)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H19ClN4/c22-18-11-10-17(13-23)19(12-18)14-6-8-16(9-7-14)21(25)26-20(24)15-4-2-1-3-5-15/h1-12H,13,23H2,(H3,24,25,26) |
| InChIKey | CTIHIDATWOTTHT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|