C45H31N3 — CID 146551315
N'-(3,5-diphenylbenzenecarboximidoyl)-9,9'-spirobi[fluorene]-2-carboximidamide (PubChem CID 146551315) has the molecular formula C45H31N3 and a molecular weight of 613.76 g/mol. Its IUPAC name is N'-(3,5-diphenylbenzenecarboximidoyl)-9,9'-spirobi[fluorene]-2-carboximidamide.
| Compound Name | N'-(3,5-diphenylbenzenecarboximidoyl)-9,9'-spirobi[fluorene]-2-carboximidamide |
|---|---|
| PubChem CID | 146551315 |
| Molecular Formula | C45H31N3 |
| Molecular Weight | 613.76 g/mol |
| Exact Mass | 613.25 |
| IUPAC Name | N'-(3,5-diphenylbenzenecarboximidoyl)-9,9'-spirobi[fluorene]-2-carboximidamide |
| SMILES | [H]/N=C(/N=C(\N)c1ccc2c(c1)C1(c3ccccc3-c3ccccc31)c1ccccc1-2)c1cc(-c2ccccc2)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C45H31N3/c46-43(48-44(47)34-26-32(29-13-3-1-4-14-29)25-33(27-34)30-15-5-2-6-16-30)31-23-24-38-37-19-9-12-22-41(37)45(42(38)28-31)39-20-10-7-17-35(39)36-18-8-11-21-40(36)45/h1-28H,(H3,46,47,48) |
| InChIKey | MJIFYKJKECIRPX-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.76 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|