C39H31N3 — CID 137285198
N-[(3,5-diphenylphenyl)-(methylamino)methylidene]-3,5-diphenylbenzenecarboximidamide (PubChem CID 137285198) has the molecular formula C39H31N3 and a molecular weight of 541.70 g/mol. Its IUPAC name is N-[(3,5-diphenylphenyl)-(methylamino)methylidene]-3,5-diphenylbenzenecarboximidamide.
| Compound Name | N-[(3,5-diphenylphenyl)-(methylamino)methylidene]-3,5-diphenylbenzenecarboximidamide |
|---|---|
| PubChem CID | 137285198 |
| Molecular Formula | C39H31N3 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | N-[(3,5-diphenylphenyl)-(methylamino)methylidene]-3,5-diphenylbenzenecarboximidamide |
| SMILES | [H]/N=C(/N=C(\NC)c1cc(-c2ccccc2)cc(-c2ccccc2)c1)c1cc(-c2ccccc2)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C39H31N3/c1-41-39(37-26-34(30-18-10-4-11-19-30)23-35(27-37)31-20-12-5-13-21-31)42-38(40)36-24-32(28-14-6-2-7-15-28)22-33(25-36)29-16-8-3-9-17-29/h2-27H,1H3,(H2,40,41,42) |
| InChIKey | ZEDZEQDCJXSYSE-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|