C33H26N2O — CID 170143185
N-[cyclohexa-1,5-dien-1-yl-(8-methyldibenzofuran-1-yl)methylidene]-4-phenylbenzenecarboximidamide (PubChem CID 170143185) has the molecular formula C33H26N2O and a molecular weight of 466.58 g/mol. Its IUPAC name is N-[cyclohexa-1,5-dien-1-yl-(8-methyldibenzofuran-1-yl)methylidene]-4-phenylbenzenecarboximidamide.
| Compound Name | N-[cyclohexa-1,5-dien-1-yl-(8-methyldibenzofuran-1-yl)methylidene]-4-phenylbenzenecarboximidamide |
|---|---|
| PubChem CID | 170143185 |
| Molecular Formula | C33H26N2O |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | N-[cyclohexa-1,5-dien-1-yl-(8-methyldibenzofuran-1-yl)methylidene]-4-phenylbenzenecarboximidamide |
| SMILES | [H]/N=C(/N=C(\C1=CCCC=C1)c1cccc2oc3ccc(C)cc3c12)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H26N2O/c1-22-15-20-29-28(21-22)31-27(13-8-14-30(31)36-29)32(25-11-6-3-7-12-25)35-33(34)26-18-16-24(17-19-26)23-9-4-2-5-10-23/h2,4-6,8-21,34H,3,7H2,1H3/b34-33+,35-32+ |
| InChIKey | FGPZKEDWEGSFSS-LQTIRQTFSA-N |
| XLogP | 8.65 |
| TPSA | 49.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|