C39H43N3O — CID 153369414
N-[(E)-1-amino-2-[(Z)-prop-1-enyl]pent-2-enylidene]-4-phenylbenzenecarboximidamide;ethane;1-methyl-8-prop-2-enyldibenzofuran (PubChem CID 153369414) has the molecular formula C39H43N3O and a molecular weight of 569.79 g/mol. Its IUPAC name is N-[(E)-1-amino-2-[(Z)-prop-1-enyl]pent-2-enylidene]-4-phenylbenzenecarboximidamide;ethane;1-methyl-8-prop-2-enyldibenzofuran.
| Compound Name | N-[(E)-1-amino-2-[(Z)-prop-1-enyl]pent-2-enylidene]-4-phenylbenzenecarboximidamide;ethane;1-methyl-8-prop-2-enyldibenzofuran |
|---|---|
| PubChem CID | 153369414 |
| Molecular Formula | C39H43N3O |
| Molecular Weight | 569.79 g/mol |
| Exact Mass | 569.34 |
| IUPAC Name | N-[(E)-1-amino-2-[(Z)-prop-1-enyl]pent-2-enylidene]-4-phenylbenzenecarboximidamide;ethane;1-methyl-8-prop-2-enyldibenzofuran |
| SMILES | C=CCc1ccc2oc3cccc(C)c3c2c1.CC.[H]/N=C(\N=C(N)\C(/C=C\C)=C\CC)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H23N3.C16H14O.C2H6/c1-3-8-18(9-4-2)20(22)24-21(23)19-14-12-17(13-15-19)16-10-6-5-7-11-16;1-3-5-12-8-9-14-13(10-12)16-11(2)6-4-7-15(16)17-14;1-2/h3,5-15H,4H2,1-2H3,(H3,22,23,24);3-4,6-10H,1,5H2,2H3;1-2H3/b8-3-,18-9+;; |
| InChIKey | YUHQCYATJZISTE-DBEBDLAUSA-N |
| XLogP | 10.60 |
| TPSA | 75.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.79 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|