C34H27N3O — CID 146263615
8-(4-anilino-3-methylphenyl)-N-(1-phenylethylidene)dibenzofuran-1-carboximidamide (PubChem CID 146263615) has the molecular formula C34H27N3O and a molecular weight of 493.61 g/mol. Its IUPAC name is 8-(4-anilino-3-methylphenyl)-N-(1-phenylethylidene)dibenzofuran-1-carboximidamide.
| Compound Name | 8-(4-anilino-3-methylphenyl)-N-(1-phenylethylidene)dibenzofuran-1-carboximidamide |
|---|---|
| PubChem CID | 146263615 |
| Molecular Formula | C34H27N3O |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | 8-(4-anilino-3-methylphenyl)-N-(1-phenylethylidene)dibenzofuran-1-carboximidamide |
| SMILES | [H]/N=C(\N=C(/C)c1ccccc1)c1cccc2oc3ccc(-c4ccc(Nc5ccccc5)c(C)c4)cc3c12 |
| InChI | InChI=1S/C34H27N3O/c1-22-20-25(16-18-30(22)37-27-12-7-4-8-13-27)26-17-19-31-29(21-26)33-28(14-9-15-32(33)38-31)34(35)36-23(2)24-10-5-3-6-11-24/h3-21,35,37H,1-2H3/b35-34-,36-23+ |
| InChIKey | CIMBXTFTKUCVTQ-VLEIZQFCSA-N |
| XLogP | 9.14 |
| TPSA | 61.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|