C40H33N3O2 — CID 170129114
N-[[methyl-[(5-methyl-2-methylidene-5H-1-benzoxepin-8-yl)methyl]amino]-phenylmethylidene]-8-phenyldibenzofuran-1-carboximidamide (PubChem CID 170129114) has the molecular formula C40H33N3O2 and a molecular weight of 587.72 g/mol. Its IUPAC name is N-[[methyl-[(5-methyl-2-methylidene-5H-1-benzoxepin-8-yl)methyl]amino]-phenylmethylidene]-8-phenyldibenzofuran-1-carboximidamide.
| Compound Name | N-[[methyl-[(5-methyl-2-methylidene-5H-1-benzoxepin-8-yl)methyl]amino]-phenylmethylidene]-8-phenyldibenzofuran-1-carboximidamide |
|---|---|
| PubChem CID | 170129114 |
| Molecular Formula | C40H33N3O2 |
| Molecular Weight | 587.72 g/mol |
| Exact Mass | 587.26 |
| IUPAC Name | N-[[methyl-[(5-methyl-2-methylidene-5H-1-benzoxepin-8-yl)methyl]amino]-phenylmethylidene]-8-phenyldibenzofuran-1-carboximidamide |
| SMILES | [H]/N=C(/N=C(/c1ccccc1)N(C)Cc1ccc2c(c1)OC(=C)C=CC2C)c1cccc2oc3ccc(-c4ccccc4)cc3c12 |
| InChI | InChI=1S/C40H33N3O2/c1-26-17-18-27(2)44-37-23-28(19-21-32(26)37)25-43(3)40(30-13-8-5-9-14-30)42-39(41)33-15-10-16-36-38(33)34-24-31(20-22-35(34)45-36)29-11-6-4-7-12-29/h4-24,26,41H,2,25H2,1,3H3/b41-39+,42-40- |
| InChIKey | ZHNFEONYBDVADI-ITRZRYQLSA-N |
| XLogP | 9.72 |
| TPSA | 61.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.72 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|