About N-[cyclohexa-1,5-dien-1-yl-[1-iodoethyl(methyl)amino]methylidene]benzenecarboximidamide
N-[cyclohexa-1,5-dien-1-yl-[1-iodoethyl(methyl)amino]methylidene]benzenecarboximidamide (PubChem CID 126699904) has the molecular formula C17H20IN3
and a molecular weight of 393.27 g/mol. Its IUPAC name is N-[cyclohexa-1,5-dien-1-yl-[1-iodoethyl(methyl)amino]methylidene]benzenecarboximidamide.
Molecular Properties
| Compound Name | N-[cyclohexa-1,5-dien-1-yl-[1-iodoethyl(methyl)amino]methylidene]benzenecarboximidamide |
| PubChem CID | 126699904 |
| Molecular Formula | C17H20IN3 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | N-[cyclohexa-1,5-dien-1-yl-[1-iodoethyl(methyl)amino]methylidene]benzenecarboximidamide |
| SMILES | [H]/N=C(/N=C(\C1=CCCC=C1)N(C)C(C)I)c1ccccc1 |
| InChI | InChI=1S/C17H20IN3/c1-13(18)21(2)17(15-11-7-4-8-12-15)20-16(19)14-9-5-3-6-10-14/h3,5-7,9-13,19H,4,8H2,1-2H3/b19-16+,20-17+ |
| InChIKey | WCFBLZZHYOBNMJ-VQZJLROISA-N |
| XLogP | 4.40 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-[cyclohexa-1,5-dien-1-yl-[1-iodoethyl(methyl)amino]methylidene]benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[cyclohexa-1,5-dien-1-yl-[1-iodoethyl(methyl)amino]methylidene]benzenecarboximidamide?
The IUPAC name of N-[cyclohexa-1,5-dien-1-yl-[1-iodoethyl(methyl)amino]methylidene]benzenecarboximidamide (CID 126699904) is N-[cyclohexa-1,5-dien-1-yl-[1-iodoethyl(methyl)amino]methylidene]benzenecarboximidamide.
What is the SMILES notation for N-[cyclohexa-1,5-dien-1-yl-[1-iodoethyl(methyl)amino]methylidene]benzenecarboximidamide?
The canonical SMILES for N-[cyclohexa-1,5-dien-1-yl-[1-iodoethyl(methyl)amino]methylidene]benzenecarboximidamide is [H]/N=C(/N=C(\C1=CCCC=C1)N(C)C(C)I)c1ccccc1.
What is the InChIKey of N-[cyclohexa-1,5-dien-1-yl-[1-iodoethyl(methyl)amino]methylidene]benzenecarboximidamide?
The InChIKey is WCFBLZZHYOBNMJ-VQZJLROISA-N. The full InChI is InChI=1S/C17H20IN3/c1-13(18)21(2)17(15-11-7-4-8-12-15)20-16(19)14-9-5-3-6-10-14/h3,5-7,9-13,19H,4,8H2,1-2H3/b19-16+,20-17+.
What are the key properties of N-[cyclohexa-1,5-dien-1-yl-[1-iodoethyl(methyl)amino]methylidene]benzenecarboximidamide?
N-[cyclohexa-1,5-dien-1-yl-[1-iodoethyl(methyl)amino]methylidene]benzenecarboximidamide has a molecular weight of 393.27 g/mol, XLogP of 4.40, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[cyclohexa-1,5-dien-1-yl-[1-iodoethyl(methyl)amino]methylidene]benzenecarboximidamide is sourced from PubChem (CID 126699904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).