C19H26N2 — CID 123238943
4-benzylimino-4-cyclohexa-1,5-dien-1-yl-3,3-dimethylbutan-2-amine (PubChem CID 123238943) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 4-benzylimino-4-cyclohexa-1,5-dien-1-yl-3,3-dimethylbutan-2-amine.
| Compound Name | 4-benzylimino-4-cyclohexa-1,5-dien-1-yl-3,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 123238943 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 4-benzylimino-4-cyclohexa-1,5-dien-1-yl-3,3-dimethylbutan-2-amine |
| SMILES | CC(N)C(C)(C)/C(=N/Cc1ccccc1)C1=CCCC=C1 |
| InChI | InChI=1S/C19H26N2/c1-15(20)19(2,3)18(17-12-8-5-9-13-17)21-14-16-10-6-4-7-11-16/h4,6-8,10-13,15H,5,9,14,20H2,1-3H3/b21-18+ |
| InChIKey | WKDWKFYBYBYJAW-DYTRJAOYSA-N |
| XLogP | 4.28 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|