C43H36N2O — CID 144955838
N'-[1-[8-[4-methyl-3-(2-methylphenyl)phenyl]-7,8-dihydrodibenzofuran-1-yl]ethenyl]-N-(1-phenylethylidene)benzenecarboximidamide (PubChem CID 144955838) has the molecular formula C43H36N2O and a molecular weight of 596.77 g/mol. Its IUPAC name is N'-[1-[8-[4-methyl-3-(2-methylphenyl)phenyl]-7,8-dihydrodibenzofuran-1-yl]ethenyl]-N-(1-phenylethylidene)benzenecarboximidamide.
| Compound Name | N'-[1-[8-[4-methyl-3-(2-methylphenyl)phenyl]-7,8-dihydrodibenzofuran-1-yl]ethenyl]-N-(1-phenylethylidene)benzenecarboximidamide |
|---|---|
| PubChem CID | 144955838 |
| Molecular Formula | C43H36N2O |
| Molecular Weight | 596.77 g/mol |
| Exact Mass | 596.28 |
| IUPAC Name | N'-[1-[8-[4-methyl-3-(2-methylphenyl)phenyl]-7,8-dihydrodibenzofuran-1-yl]ethenyl]-N-(1-phenylethylidene)benzenecarboximidamide |
| SMILES | C=C(/N=C(\N=C(/C)c1ccccc1)c1ccccc1)c1cccc2oc3c(c12)=CC(c1ccc(C)c(-c2ccccc2C)c1)CC=3 |
| InChI | InChI=1S/C43H36N2O/c1-28-14-11-12-19-36(28)38-26-34(23-22-29(38)2)35-24-25-40-39(27-35)42-37(20-13-21-41(42)46-40)31(4)45-43(33-17-9-6-10-18-33)44-30(3)32-15-7-5-8-16-32/h5-23,25-27,35H,4,24H2,1-3H3/b44-30+,45-43- |
| InChIKey | UXGARGJMOFXSRP-ONFZHFDTSA-N |
| XLogP | 9.39 |
| TPSA | 37.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.77 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|