C30H30N2O — CID 153368904
2,3-bis(ethenyl)-N'-methyl-N-[1-(4-phenylphenyl)ethylidene]-1-benzofuran-4-carboximidamide;ethane (PubChem CID 153368904) has the molecular formula C30H30N2O and a molecular weight of 434.58 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-N'-methyl-N-[1-(4-phenylphenyl)ethylidene]-1-benzofuran-4-carboximidamide;ethane.
| Compound Name | 2,3-bis(ethenyl)-N'-methyl-N-[1-(4-phenylphenyl)ethylidene]-1-benzofuran-4-carboximidamide;ethane |
|---|---|
| PubChem CID | 153368904 |
| Molecular Formula | C30H30N2O |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 2,3-bis(ethenyl)-N'-methyl-N-[1-(4-phenylphenyl)ethylidene]-1-benzofuran-4-carboximidamide;ethane |
| SMILES | C=Cc1oc2cccc(C(=N/C)/N=C(\C)c3ccc(-c4ccccc4)cc3)c2c1C=C.CC |
| InChI | InChI=1S/C28H24N2O.C2H6/c1-5-23-25(6-2)31-26-14-10-13-24(27(23)26)28(29-4)30-19(3)20-15-17-22(18-16-20)21-11-8-7-9-12-21;1-2/h5-18H,1-2H2,3-4H3;1-2H3/b29-28-,30-19+; |
| InChIKey | MPSDQAZBGVMBRG-HEQFEDHRSA-N |
| XLogP | 8.30 |
| TPSA | 37.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|