C53H48N2 — CID 146384812
N-[1-(4-phenylphenyl)ethylidene]-N'-[1-[4-[1-[4-(3-phenylphenyl)phenyl]cyclohexyl]phenyl]ethenyl]cyclohexa-1,5-diene-1-carboximidamide (PubChem CID 146384812) has the molecular formula C53H48N2 and a molecular weight of 712.98 g/mol. Its IUPAC name is N-[1-(4-phenylphenyl)ethylidene]-N'-[1-[4-[1-[4-(3-phenylphenyl)phenyl]cyclohexyl]phenyl]ethenyl]cyclohexa-1,5-diene-1-carboximidamide.
| Compound Name | N-[1-(4-phenylphenyl)ethylidene]-N'-[1-[4-[1-[4-(3-phenylphenyl)phenyl]cyclohexyl]phenyl]ethenyl]cyclohexa-1,5-diene-1-carboximidamide |
|---|---|
| PubChem CID | 146384812 |
| Molecular Formula | C53H48N2 |
| Molecular Weight | 712.98 g/mol |
| Exact Mass | 712.38 |
| IUPAC Name | N-[1-(4-phenylphenyl)ethylidene]-N'-[1-[4-[1-[4-(3-phenylphenyl)phenyl]cyclohexyl]phenyl]ethenyl]cyclohexa-1,5-diene-1-carboximidamide |
| SMILES | C=C(/N=C(\N=C(/C)c1ccc(-c2ccccc2)cc1)C1=CCCC=C1)c1ccc(C2(c3ccc(-c4cccc(-c5ccccc5)c4)cc3)CCCCC2)cc1 |
| InChI | InChI=1S/C53H48N2/c1-39(41-24-26-45(27-25-41)43-16-7-3-8-17-43)54-52(47-20-11-5-12-21-47)55-40(2)42-28-32-50(33-29-42)53(36-13-6-14-37-53)51-34-30-46(31-35-51)49-23-15-22-48(38-49)44-18-9-4-10-19-44/h3-4,7-11,15-35,38H,2,5-6,12-14,36-37H2,1H3/b54-39+,55-52- |
| InChIKey | WSBNBLBJBUCZEL-HAAGQXFLSA-N |
| XLogP | 14.09 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.98 |
| LogP ≤ 5 | 14.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|