C33H30 — CID 153369732
9,9-dimethyl-1-[4-methyl-2-[(3E)-4-phenylpenta-1,3-dien-2-yl]phenyl]fluorene (PubChem CID 153369732) has the molecular formula C33H30 and a molecular weight of 426.60 g/mol. Its IUPAC name is 9,9-dimethyl-1-[4-methyl-2-[(3E)-4-phenylpenta-1,3-dien-2-yl]phenyl]fluorene.
| Compound Name | 9,9-dimethyl-1-[4-methyl-2-[(3E)-4-phenylpenta-1,3-dien-2-yl]phenyl]fluorene |
|---|---|
| PubChem CID | 153369732 |
| Molecular Formula | C33H30 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 9,9-dimethyl-1-[4-methyl-2-[(3E)-4-phenylpenta-1,3-dien-2-yl]phenyl]fluorene |
| SMILES | C=C(/C=C(\C)c1ccccc1)c1cc(C)ccc1-c1cccc2c1C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C33H30/c1-22-18-19-26(30(20-22)24(3)21-23(2)25-12-7-6-8-13-25)28-15-11-16-29-27-14-9-10-17-31(27)33(4,5)32(28)29/h6-21H,3H2,1-2,4-5H3/b23-21+ |
| InChIKey | ZQRHYVSOFKUAPO-XTQSDGFTSA-N |
| XLogP | 9.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|