C42H39N — CID 123291128
N-(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-N-[4-(4-methylpenta-2,4-dien-2-yl)phenyl]fluoren-2-amine (PubChem CID 123291128) has the molecular formula C42H39N and a molecular weight of 557.78 g/mol. Its IUPAC name is N-(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-N-[4-(4-methylpenta-2,4-dien-2-yl)phenyl]fluoren-2-amine.
| Compound Name | N-(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-N-[4-(4-methylpenta-2,4-dien-2-yl)phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 123291128 |
| Molecular Formula | C42H39N |
| Molecular Weight | 557.78 g/mol |
| Exact Mass | 557.31 |
| IUPAC Name | N-(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-N-[4-(4-methylpenta-2,4-dien-2-yl)phenyl]fluoren-2-amine |
| SMILES | C=C(C)C=C(C)c1ccc(N(c2ccc3c(c2)C(C)(C)c2ccccc2-3)c2ccc3c(c2)C(C)(C)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C42H39N/c1-27(2)24-28(3)29-16-18-30(19-17-29)43(31-20-22-35-33-12-8-10-14-37(33)41(4,5)39(35)25-31)32-21-23-36-34-13-9-11-15-38(34)42(6,7)40(36)26-32/h8-26H,1H2,2-7H3 |
| InChIKey | HCWNCVLAVPOTRH-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.78 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|