C62H48N2 — CID 145452834
(Z)-1-[3-[5-(9,9-dimethylfluoren-2-yl)triphenylen-2-yl]phenyl]-N'-methylidene-3-(4-phenylphenyl)prop-2-ene-1,3-diimine;toluene (PubChem CID 145452834) has the molecular formula C62H48N2 and a molecular weight of 821.08 g/mol. Its IUPAC name is (Z)-1-[3-[5-(9,9-dimethylfluoren-2-yl)triphenylen-2-yl]phenyl]-N'-methylidene-3-(4-phenylphenyl)prop-2-ene-1,3-diimine;toluene.
| Compound Name | (Z)-1-[3-[5-(9,9-dimethylfluoren-2-yl)triphenylen-2-yl]phenyl]-N'-methylidene-3-(4-phenylphenyl)prop-2-ene-1,3-diimine;toluene |
|---|---|
| PubChem CID | 145452834 |
| Molecular Formula | C62H48N2 |
| Molecular Weight | 821.08 g/mol |
| Exact Mass | 820.38 |
| IUPAC Name | (Z)-1-[3-[5-(9,9-dimethylfluoren-2-yl)triphenylen-2-yl]phenyl]-N'-methylidene-3-(4-phenylphenyl)prop-2-ene-1,3-diimine;toluene |
| SMILES | Cc1ccccc1.[H]/N=C(\C=C(/N=C)c1ccc(-c2ccccc2)cc1)c1cccc(-c2ccc3c(c2)c2ccccc2c2cccc(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)c23)c1 |
| InChI | InChI=1S/C55H40N2.C7H8/c1-55(2)50-22-10-9-19-45(50)46-29-28-40(33-51(46)55)42-20-12-21-47-43-17-7-8-18-44(43)49-32-39(27-30-48(49)54(42)47)38-15-11-16-41(31-38)52(56)34-53(57-3)37-25-23-36(24-26-37)35-13-5-4-6-14-35;1-7-5-3-2-4-6-7/h4-34,56H,3H2,1-2H3;2-6H,1H3/b53-34-,56-52+; |
| InChIKey | XBNVUINPEFPVMS-PSJZLEGTSA-N |
| XLogP | 16.56 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.08 |
| LogP ≤ 5 | 16.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|