C47H40N2 — CID 134350516
(Z)-1,3-bis[4-(9,9-dimethylfluoren-2-yl)phenyl]-N-methyl-N'-methylideneprop-2-ene-1,3-diimine (PubChem CID 134350516) has the molecular formula C47H40N2 and a molecular weight of 632.85 g/mol. Its IUPAC name is (Z)-1,3-bis[4-(9,9-dimethylfluoren-2-yl)phenyl]-N-methyl-N'-methylideneprop-2-ene-1,3-diimine.
| Compound Name | (Z)-1,3-bis[4-(9,9-dimethylfluoren-2-yl)phenyl]-N-methyl-N'-methylideneprop-2-ene-1,3-diimine |
|---|---|
| PubChem CID | 134350516 |
| Molecular Formula | C47H40N2 |
| Molecular Weight | 632.85 g/mol |
| Exact Mass | 632.32 |
| IUPAC Name | (Z)-1,3-bis[4-(9,9-dimethylfluoren-2-yl)phenyl]-N-methyl-N'-methylideneprop-2-ene-1,3-diimine |
| SMILES | C=N/C(=C\C(=N\C)c1ccc(-c2ccc3c(c2)C(C)(C)c2ccccc2-3)cc1)c1ccc(-c2ccc3c(c2)C(C)(C)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C47H40N2/c1-46(2)40-13-9-7-11-36(40)38-25-23-34(27-42(38)46)30-15-19-32(20-16-30)44(48-5)29-45(49-6)33-21-17-31(18-22-33)35-24-26-39-37-12-8-10-14-41(37)47(3,4)43(39)28-35/h7-29H,5H2,1-4,6H3/b44-29-,49-45- |
| InChIKey | DXLLCRQZZVGHQZ-YHHFNQTKSA-N |
| XLogP | 11.79 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.85 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|