C18H19N — CID 123301192
1-(9,9-dimethylfluoren-2-yl)-N-methylethanimine (PubChem CID 123301192) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-(9,9-dimethylfluoren-2-yl)-N-methylethanimine.
| Compound Name | 1-(9,9-dimethylfluoren-2-yl)-N-methylethanimine |
|---|---|
| PubChem CID | 123301192 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1-(9,9-dimethylfluoren-2-yl)-N-methylethanimine |
| SMILES | C/N=C(\C)c1ccc2c(c1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C18H19N/c1-12(19-4)13-9-10-15-14-7-5-6-8-16(14)18(2,3)17(15)11-13/h5-11H,1-4H3/b19-12+ |
| InChIKey | RODZCFMJZJYLAG-XDHOZWIPSA-N |
| XLogP | 4.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|